ChemNet > CAS > 3085-42-5 4-Chlorophenyl sulfoxide
3085-42-5 4-Chlorophenyl sulfoxide
상품명칭 |
4-Chlorophenyl sulfoxide |
영문 이름 |
4-Chlorophenyl sulfoxide; Bis(4-chlorophenyl) sulfoxide; 4-Chlorophenyl sulphoxide~4,4-Dichlorodiphenyl sulphoxide; 4,4-Dichlorodiphenyl sulfoxide; 1,1'-sulfinylbis(4-chlorobenzene) |
분자식 |
C12H8Cl2OS |
분자량 |
271.1623 |
InChI |
InChI=1/C12H8Cl2OS/c13-9-1-5-11(6-2-9)16(15)12-7-3-10(14)4-8-12/h1-8H |
cas번호 |
3085-42-5 |
EC번호 |
221-397-9 |
분자 구조 |
|
밀도 |
1.48g/cm3 |
녹는 점 |
140-145℃ |
비등점 |
406.2°C at 760 mmHg |
굴절 지수 |
1.689 |
인화점 |
199.5°C |
증기압 |
1.94E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|