3088-42-4 N-(2-Cyanoethyl)glycine
상품명칭 |
N-(2-Cyanoethyl)glycine |
영문 이름 |
N-(2-Cyanoethyl)glycine; N-(2-Cyanoehtyl)glycine |
분자식 |
C5H8N2O2 |
분자량 |
128.1292 |
InChI |
InChI=1/C5H8N2O2/c6-2-1-3-7-4-5(8)9/h7H,1,3-4H2,(H,8,9) |
cas번호 |
3088-42-4 |
EC번호 |
221-418-1 |
분자 구조 |
|
밀도 |
1.187g/cm3 |
녹는 점 |
188-193℃ |
비등점 |
343.1°C at 760 mmHg |
굴절 지수 |
1.473 |
인화점 |
161.3°C |
증기압 |
1.3E-05mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21:Harmful by inhalation and in contact with skin.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|