3088-79-7 n-Dodecylboronic acid
상품명칭 |
n-Dodecylboronic acid |
영문 이름 |
n-Dodecylboronic acid; n-Dodecaneboronic acid~Laurylboronic acid; dodecylboronic acid |
분자식 |
C12H27BO2 |
분자량 |
214.1526 |
InChI |
InChI=1/C12H27BO2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h14-15H,2-12H2,1H3 |
cas번호 |
3088-79-7 |
분자 구조 |
|
밀도 |
0.879g/cm3 |
비등점 |
329.8°C at 760 mmHg |
굴절 지수 |
1.439 |
인화점 |
153.2°C |
증기압 |
1.28E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|