ChemNet > CAS > 3096-52-4 2-nitro-9-fluorenone
3096-52-4 2-nitro-9-fluorenone
| 상품명칭 |
2-nitro-9-fluorenone |
| 영문 이름 |
2-nitro-9-fluorenone;2-Nitro-9-fluorenone; 4-07-00-01636 (Beilstein Handbook Reference); BRN 2052959; CCRIS 2540; NSC 12365; 9H-Fluoren-9-one, 2-nitro-; 2-nitro-9H-fluoren-9-one |
| 분자식 |
C13H7NO3 |
| 분자량 |
225.1996 |
| InChI |
InChI=1/C13H7NO3/c15-13-11-4-2-1-3-9(11)10-6-5-8(14(16)17)7-12(10)13/h1-7H |
| cas번호 |
3096-52-4 |
| 분자 구조 |
|
| 밀도 |
1.437g/cm3 |
| 녹는 점 |
222-223℃ |
| 비등점 |
419°C at 760 mmHg |
| 굴절 지수 |
1.698 |
| 인화점 |
215.1°C |
| 증기압 |
3.13E-07mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
