ChemNet > CAS > 3102-87-2 2,3,5,6-Tetramethyl-p-phenylenediamine
3102-87-2 2,3,5,6-Tetramethyl-p-phenylenediamine
| 상품명칭 |
2,3,5,6-Tetramethyl-p-phenylenediamine |
| 영문 이름 |
2,3,5,6-Tetramethyl-p-phenylenediamine; 3,6-Diaminodurene; 2,3,5,6-tetramethylbenzene-1,4-diamine; 2,3,5,6-tetramethyl-1,4-phenylenediamine |
| 분자식 |
C10H16N2 |
| 분자량 |
164.2474 |
| InChI |
InChI=1/C10H16N2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h11-12H2,1-4H3 |
| cas번호 |
3102-87-2 |
| EC번호 |
221-457-4 |
| 분자 구조 |
|
| 밀도 |
1.032g/cm3 |
| 녹는 점 |
150-153℃ |
| 비등점 |
310.6°C at 760 mmHg |
| 굴절 지수 |
1.594 |
| 인화점 |
167.8°C |
| 증기압 |
0.000595mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
