ChemNet > CAS > 3113-72-2 5-methyl-2-nitrobenzoic acid
3113-72-2 5-methyl-2-nitrobenzoic acid
상품명칭 |
5-methyl-2-nitrobenzoic acid |
영문 이름 |
5-methyl-2-nitrobenzoic acid; 6-Nitro-m-toluic acid; 2-Nitro-5-Methylbenzoicacid; 2-Nitro-5-methylbenzoic acid |
분자식 |
C8H7NO4 |
분자량 |
181.1455 |
InChI |
InChI=1/C8H7NO4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11) |
cas번호 |
3113-72-2 |
EC번호 |
221-481-5 |
분자 구조 |
|
밀도 |
1.392g/cm3 |
녹는 점 |
134-136℃ |
비등점 |
367.6°C at 760 mmHg |
굴절 지수 |
1.6 |
인화점 |
166.8°C |
증기압 |
4.72E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|