ChemNet > CAS > 312-21-0 4-(Trifluoromethylsulfonyl)benzonitrile
312-21-0 4-(Trifluoromethylsulfonyl)benzonitrile
| 상품명칭 |
4-(Trifluoromethylsulfonyl)benzonitrile |
| 영문 이름 |
4-(Trifluoromethylsulfonyl)benzonitrile; 4-Cyanophenyl trifluoromethyl sulphone; 4-(Trifluoromethylsulphonyl)benzonitrile; 4-(Trifluoromethanesulfonyl)benzonitrile |
| 분자식 |
C6H4FNO |
| 분자량 |
125.1005 |
| InChI |
InChI=1/C6H4FNO/c7-5-2-1-3-8-6(5)4-9/h1-4H |
| cas번호 |
312-21-0 |
| 분자 구조 |
|
| 밀도 |
1.269g/cm3 |
| 녹는 점 |
84-88℃ |
| 비등점 |
166.5°C at 760 mmHg |
| 굴절 지수 |
1.543 |
| 인화점 |
54.5°C |
| 증기압 |
1.78mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
