ChemNet > CAS > 3125-64-2 3-Methoxyphenyl isothiocyanate
3125-64-2 3-Methoxyphenyl isothiocyanate
| 상품명칭 |
3-Methoxyphenyl isothiocyanate |
| 영문 이름 |
3-Methoxyphenyl isothiocyanate; m-Anisyl isothiocyanate; 3-(Isothiocyanato)-anisole |
| 분자식 |
C8H7NOS |
| 분자량 |
165.20 |
| InChI |
InChI=1/C8H7NOS/c1-10-8-4-2-3-7(5-8)9-6-11/h2-5H,1H3 |
| cas번호 |
3125-64-2 |
| 분자 구조 |
|
| 밀도 |
1.179 |
| 비등점 |
133℃(10 torr) |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
