ChemNet > CAS > 3129-92-8 benzoic acid, compound with cyclohexylamine (1:1)
3129-92-8 benzoic acid, compound with cyclohexylamine (1:1)
| 상품명칭 |
benzoic acid, compound with cyclohexylamine (1:1) |
| 영문 이름 |
benzoic acid, compound with cyclohexylamine (1:1);Benzoic acid, compd. with cyclohexanamine (1:1); Benzoic acid, compd. with cyclohexylamine (1:1); Cyclohexylamine benzoate; Cyclohexylammonium benzoate; N-Cyclohexylammonium benzoate; NSC 211025; Benzoic acid, compd. with cyclohexylamine (1:1) (8CI); Benzoic acid, compound with cyclohexylamine (1:1); cyclohexanamine benzoate (1:1) |
| 분자식 |
C13H19NO2 |
| 분자량 |
221.2955 |
| InChI |
InChI=1/C7H6O2.C6H13N/c8-7(9)6-4-2-1-3-5-6;7-6-4-2-1-3-5-6/h1-5H,(H,8,9);6H,1-5,7H2 |
| cas번호 |
3129-92-8 |
| EC번호 |
221-516-4 |
| 분자 구조 |
|
| 비등점 |
249.3°C at 760 mmHg |
| 인화점 |
111.4°C |
| 증기압 |
0.0122mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
|
|
