ChemNet > CAS > 3138-86-1 2,3-Bis(bromomethyl)quinoxaline
3138-86-1 2,3-Bis(bromomethyl)quinoxaline
상품명칭 |
2,3-Bis(bromomethyl)quinoxaline |
영문 이름 |
2,3-Bis(bromomethyl)quinoxaline; 2,3-Bis-(bromethyl)-quinoxaline 98% |
분자식 |
C10H8Br2N2 |
분자량 |
315.9919 |
InChI |
InChI=1/C10H8Br2N2/c11-5-9-10(6-12)14-8-4-2-1-3-7(8)13-9/h1-4H,5-6H2 |
cas번호 |
3138-86-1 |
EC번호 |
221-538-4 |
분자 구조 |
|
밀도 |
1.869g/cm3 |
녹는 점 |
150-154℃ |
비등점 |
345.7°C at 760 mmHg |
굴절 지수 |
1.703 |
인화점 |
162.9°C |
증기압 |
0.000121mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|