3141-25-1 2,3,4-Tribromothiophene
상품명칭 |
2,3,4-Tribromothiophene |
영문 이름 |
2,3,4-Tribromothiophene; |
분자식 |
C4HBr3S |
분자량 |
320.8277 |
InChI |
InChI=1/C4HBr3S/c5-2-1-8-4(7)3(2)6/h1H |
cas번호 |
3141-25-1 |
EC번호 |
221-545-2 |
분자 구조 |
|
밀도 |
2.516g/cm3 |
비등점 |
277.5°C at 760 mmHg |
굴절 지수 |
1.671 |
인화점 |
121.6°C |
증기압 |
0.00762mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|