ChemNet > CAS > 3141-93-3 1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one
3141-93-3 1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one
| 상품명칭 |
1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one |
| 영문 이름 |
1-(3,4-dimethoxyphenyl)-2-phenylethan-1-one; 1-(3,4-dimethoxyphenyl)-2-phenylethanone |
| 분자식 |
C16H16O3 |
| 분자량 |
256.2964 |
| InChI |
InChI=1/C16H16O3/c1-18-15-9-8-13(11-16(15)19-2)14(17)10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3 |
| cas번호 |
3141-93-3 |
| 분자 구조 |
|
| 밀도 |
1.115g/cm3 |
| 녹는 점 |
87℃ |
| 비등점 |
398°C at 760 mmHg |
| 굴절 지수 |
1.558 |
| 인화점 |
186.1°C |
| 증기압 |
1.53E-06mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
