ChemNet > CAS > 3147-39-5 Methyl 2,4,6-trihydroxybenzoate
3147-39-5 Methyl 2,4,6-trihydroxybenzoate
상품명칭 |
Methyl 2,4,6-trihydroxybenzoate |
영문 이름 |
Methyl 2,4,6-trihydroxybenzoate; 2,4,6-Trihydroxybenzoic acid methyl ester; Phloroglucinolcarboxylic acid methyl ester |
분자식 |
C8H8O5 |
분자량 |
184.1461 |
InChI |
InChI=1/C8H8O5/c1-13-8(12)7-5(10)2-4(9)3-6(7)11/h2-3,9-11H,1H3 |
cas번호 |
3147-39-5 |
EC번호 |
221-566-7 |
분자 구조 |
|
밀도 |
1.501g/cm3 |
녹는 점 |
174-176℃ |
비등점 |
359.5°C at 760 mmHg |
굴절 지수 |
1.63 |
인화점 |
150.3°C |
증기압 |
1.14E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|