ChemNet > CAS > 3154-51-6 N-formylglycine ethyl ester
3154-51-6 N-formylglycine ethyl ester
| 상품명칭 |
N-formylglycine ethyl ester |
| 영문 이름 |
N-formylglycine ethyl ester; Ethyl N-formylglycinate~For-Gly-OEt; ethyl N-formylglycinate |
| 분자식 |
C5H9NO3 |
| 분자량 |
131.1299 |
| InChI |
InChI=1/C5H9NO3/c1-2-9-5(8)3-6-4-7/h4H,2-3H2,1H3,(H,6,7) |
| cas번호 |
3154-51-6 |
| EC번호 |
221-596-0 |
| 분자 구조 |
|
| 밀도 |
1.086g/cm3 |
| 비등점 |
278.4°C at 760 mmHg |
| 굴절 지수 |
1.423 |
| 인화점 |
122.2°C |
| 증기압 |
0.00427mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
