ChemNet > CAS > 31604-39-4 N-(4-Nitrophenyl)phthalimide
31604-39-4 N-(4-Nitrophenyl)phthalimide
상품명칭 |
N-(4-Nitrophenyl)phthalimide |
영문 이름 |
N-(4-Nitrophenyl)phthalimide; N-(4-Nitrophenyl)-phthalamide; 2-(4-nitrophenyl)-1H-isoindole-1,3(2H)-dione |
분자식 |
C14H8N2O4 |
분자량 |
268.2243 |
InChI |
InChI=1/C14H8N2O4/c17-13-11-3-1-2-4-12(11)14(18)15(13)9-5-7-10(8-6-9)16(19)20/h1-8H |
cas번호 |
31604-39-4 |
분자 구조 |
|
밀도 |
1.501g/cm3 |
비등점 |
494.2°C at 760 mmHg |
굴절 지수 |
1.694 |
인화점 |
252.7°C |
증기압 |
6.56E-10mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|