ChemNet > CAS > 3209-72-1 ethyl 5-methylisoxazole-3-carboxylate
3209-72-1 ethyl 5-methylisoxazole-3-carboxylate
상품명칭 |
ethyl 5-methylisoxazole-3-carboxylate |
영문 이름 |
ethyl 5-methylisoxazole-3-carboxylate; 5-methylisoxazole-3-carboxylate ethyl; ethyl 5-methyl-1,2-oxazole-3-carboxylate |
분자식 |
C7H9NO3 |
분자량 |
155.1513 |
InChI |
InChI=1/C7H9NO3/c1-3-10-7(9)6-4-5(2)11-8-6/h4H,3H2,1-2H3 |
cas번호 |
3209-72-1 |
EC번호 |
221-720-3 |
분자 구조 |
|
밀도 |
1.139g/cm3 |
녹는 점 |
25℃ |
비등점 |
246.2°C at 760 mmHg |
굴절 지수 |
1.468 |
인화점 |
102.7°C |
증기압 |
0.0275mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|