ChemNet > CAS > 325-50-8 5-Fluoro-2-methylphenylhydrazine hydrochloride
325-50-8 5-Fluoro-2-methylphenylhydrazine hydrochloride
상품명칭 |
5-Fluoro-2-methylphenylhydrazine hydrochloride |
영문 이름 |
5-Fluoro-2-methylphenylhydrazine hydrochloride; (5-fluoro-2-methylphenyl)diazanium chloride; (5-fluoro-2-methylphenyl)hydrazine; 3-Fluoro-6-methylphenylhydrazine HCl; 5-Fluoro-2-methylphenylhydrazine HCl |
분자식 |
C7H9FN2 |
분자량 |
140.1582 |
InChI |
InChI=1/C7H9FN2/c1-5-2-3-6(8)4-7(5)10-9/h2-4,10H,9H2,1H3 |
cas번호 |
325-50-8 |
분자 구조 |
|
밀도 |
1.202g/cm3 |
비등점 |
212°C at 760 mmHg |
굴절 지수 |
1.594 |
인화점 |
82°C |
증기압 |
0.177mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|