ChemNet > CAS > 3260-88-6 3-Chloro-2-methylanisole,98%
3260-88-6 3-Chloro-2-methylanisole,98%
| 상품명칭 |
3-Chloro-2-methylanisole,98% |
| 영문 이름 |
3-Chloro-2-methylanisole,98%; 3-Chloro-2-methylanisole; 2-Chloro-6-methoxytoluene~2-Methoxy-6-chlorotoluene; 1-chloro-3-methoxy-2-methylbenzene |
| 분자식 |
C8H9ClO |
| 분자량 |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c1-6-7(9)4-3-5-8(6)10-2/h3-5H,1-2H3 |
| cas번호 |
3260-88-6 |
| EC번호 |
221-862-6 |
| 분자 구조 |
|
| 밀도 |
1.105g/cm3 |
| 비등점 |
201.9°C at 760 mmHg |
| 굴절 지수 |
1.514 |
| 인화점 |
82.1°C |
| 증기압 |
0.427mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
