ChemNet > CAS > 3282-11-9 4,4''-Dinitro-p-terphenyl
3282-11-9 4,4''-Dinitro-p-terphenyl
상품명칭 |
4,4''-Dinitro-p-terphenyl |
영문 이름 |
4,4''-Dinitro-p-terphenyl;p-Terphenyl, 4,4''-dinitro-; 4,4''-dinitro-1,1':4',1''-terphenyl |
분자식 |
C18H12N2O4 |
분자량 |
320.2989 |
InChI |
InChI=1/C18H12N2O4/c21-19(22)17-9-5-15(6-10-17)13-1-2-14(4-3-13)16-7-11-18(12-8-16)20(23)24/h1-12H |
cas번호 |
3282-11-9 |
분자 구조 |
|
밀도 |
1.314g/cm3 |
비등점 |
534.4°C at 760 mmHg |
굴절 지수 |
1.646 |
인화점 |
260.2°C |
증기압 |
5.85E-11mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/22:Harmful by inhalation and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|