3291-03-0 3,4,5-Trimethoxybenzhydrazide

상품명칭	3,4,5-Trimethoxybenzhydrazide
영문 이름	3,4,5-Trimethoxybenzhydrazide;3,4,5-Trimethoxybenzohydrazide
분자식	C₁₀H₁₄N₂O₄
분자량	226.2292
InChI	InChI=1/C10H14N2O4/c1-14-7-4-6(10(13)12-11)5-8(15-2)9(7)16-3/h4-5H,11H2,1-3H3,(H,12,13)
cas번호	3291-03-0
EC번호	221-954-6
분자 구조
밀도	1.197g/cm³
굴절 지수	1.534
위험성 표시
리스크 규칙	R36/37/38:Irritating to eyes, respiratory system and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;