33155-90-7 Hydroxybenzoquinoline
상품명칭 |
Hydroxybenzoquinoline |
영문 이름 |
Hydroxybenzoquinoline; 10-Hydroxybenzo[h]quinoline; benzo[h]quinolin-10-ol |
분자식 |
C13H9NO |
분자량 |
195.2167 |
InChI |
InChI=1/C13H9NO/c15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11/h1-8,15H |
cas번호 |
33155-90-7 |
분자 구조 |
|
밀도 |
1.307g/cm3 |
비등점 |
420.621°C at 760 mmHg |
굴절 지수 |
1.768 |
인화점 |
208.184°C |
증기압 |
0mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|