ChemNet > CAS > 3316-09-4 4-Nitrocatechol
3316-09-4 4-Nitrocatechol
상품명칭 |
4-Nitrocatechol |
영문 이름 |
4-Nitrocatechol; 4-nitropyrocatechol; 3,4-Dihydroxynitrobenzene; 2-hydroxy-4-nitrophenolate; 4-nitrobenzene-1,2-diol |
분자식 |
C6H5NO4 |
분자량 |
155.1082 |
InChI |
InChI=1/C6H5NO4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H |
cas번호 |
3316-09-4 |
EC번호 |
222-009-0 |
분자 구조 |
|
밀도 |
1.58g/cm3 |
녹는 점 |
173-177℃ |
비등점 |
358.2°C at 760 mmHg |
굴절 지수 |
1.667 |
인화점 |
168.8°C |
증기압 |
1.25E-05mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|