332-43-4 1-(2-chloroethyl)-4-fluorobenzene

상품명칭	1-(2-chloroethyl)-4-fluorobenzene
영문 이름	1-(2-chloroethyl)-4-fluorobenzene; 4-Fluorophenethyl chloride~2-(4-Fluorophenyl)ethyl chloride
분자식	C₈H₈ClF
분자량	158.6005
InChI	InChI=1/C8H8ClF/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2
cas번호	332-43-4
EC번호	206-364-9
분자 구조
밀도	1.15g/cm³
비등점	204.6°C at 760 mmHg
굴절 지수	1.501
인화점	79.9°C
증기압	0.373mmHg at 25°C
위험성 표시
리스크 규칙	R36/38:Irritating to eyes and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;