3325-11-9 5-Aminobenzotriazole
상품명칭 |
5-Aminobenzotriazole |
영문 이름 |
5-Aminobenzotriazole;1H-Benzotriazol-6-amine; 1H-Benzotriazol-5-amine; 2H-benzotriazol-5-amine |
분자식 |
C6H6N4 |
분자량 |
134.1386 |
InChI |
InChI=1/C6H6N4/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H,7H2,(H,8,9,10) |
cas번호 |
3325-11-9 |
분자 구조 |
|
밀도 |
1.48g/cm3 |
비등점 |
387.4°C at 760 mmHg |
굴절 지수 |
1.806 |
인화점 |
216.5°C |
증기압 |
3.29E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|