ChemNet > CAS > 33524-31-1 2,5-Dimethoxybenzyl alcohol
33524-31-1 2,5-Dimethoxybenzyl alcohol
상품명칭 |
2,5-Dimethoxybenzyl alcohol |
영문 이름 |
2,5-Dimethoxybenzyl alcohol;(2,5-dimethoxyphenyl)methanol |
분자식 |
C9H12O3 |
분자량 |
168.1898 |
InChI |
InChI=1/C9H12O3/c1-11-8-3-4-9(12-2)7(5-8)6-10/h3-5,10H,6H2,1-2H3 |
cas번호 |
33524-31-1 |
EC번호 |
251-562-0 |
분자 구조 |
|
밀도 |
1.111g/cm3 |
비등점 |
305.6°C at 760 mmHg |
굴절 지수 |
1.521 |
인화점 |
127.7°C |
증기압 |
0.000354mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|