ChemNet > CAS > 337508-58-4 1H-benzimidazole-2-carbonyl chloride hydrochloride
337508-58-4 1H-benzimidazole-2-carbonyl chloride hydrochloride
상품명칭 |
1H-benzimidazole-2-carbonyl chloride hydrochloride |
영문 이름 |
1H-benzimidazole-2-carbonyl chloride hydrochloride;1H-benzimidazole-2-carbonyl chloride |
분자식 |
C8H5ClN2O |
분자량 |
180.5911 |
InChI |
InChI=1/C8H5ClN2O/c9-7(12)8-10-5-3-1-2-4-6(5)11-8/h1-4H,(H,10,11) |
cas번호 |
337508-58-4 |
분자 구조 |
|
밀도 |
1.486g/cm3 |
비등점 |
379.6°C at 760 mmHg |
굴절 지수 |
1.698 |
인화점 |
183.4°C |
증기압 |
5.77E-06mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|