33775-94-9 2-Iodothioanisole
상품명칭 |
2-Iodothioanisole |
영문 이름 |
2-Iodothioanisole; 2-Iodophenyl methyl sulphide~2-(Methylthio)iodobenzene; 1-Iodo-2-(methylthio)benzene; 1-iodo-2-(methylsulfanyl)benzene |
분자식 |
C7H7IS |
분자량 |
250.0999 |
InChI |
InChI=1/C7H7IS/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
cas번호 |
33775-94-9 |
분자 구조 |
|
밀도 |
1.78g/cm3 |
비등점 |
253°C at 760 mmHg |
굴절 지수 |
1.67 |
인화점 |
106.8°C |
증기압 |
0.0298mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|