ChemNet > CAS > 33797-51-2 Eschenmoser's salt
33797-51-2 Eschenmoser's salt
| 상품명칭 |
Eschenmoser's salt |
| 영문 이름 |
Eschenmoser's salt; Dimethyl methyleneammonium iodide; Eschenmosers iodide salt; N,N-Dimethylmethyleneiminium iodide; Eschenmoser salt; N-methyl-N-methylidenemethanaminium iodide |
| 분자식 |
C3H8IN |
| 분자량 |
185.0068 |
| InChI |
InChI=1/C3H8N.HI/c1-4(2)3;/h1H2,2-3H3;1H/q+1;/p-1 |
| cas번호 |
33797-51-2 |
| EC번호 |
251-680-2 |
| 분자 구조 |
|
| 녹는 점 |
219℃ |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
