ChemNet > CAS > 339-59-3 4-(Trifluoromethyl)benzhydrazide
339-59-3 4-(Trifluoromethyl)benzhydrazide
상품명칭 |
4-(Trifluoromethyl)benzhydrazide |
영문 이름 |
4-(Trifluoromethyl)benzhydrazide; 4-(Trifluoromethyl)benzohydrazide; TIMTEC-BB SBB001890; 4-(TRIFLUOROMETHYL)BENZOIC ACID HYDRAZIDE; 4-(TRIFLUOROMETHYL)BENZENE-1-CARBOHYDRAZIDE; ALPHA,ALPHA,ALPHA-TRIFLUORO-P-TOLUIC ACID HYDRAZIDE; AKOS BBS-00001991; BUTTPARK 30\01-48; ethyl N-(3-chloro-4-fluorophenyl)-N-(phenylcarbonyl)alaninate; 4-(Trifluoromethyl)-benzoic acid hydrazide |
분자식 |
C18H17ClFNO3 |
분자량 |
349.7839 |
InChI |
InChI=1/C18H17ClFNO3/c1-3-24-18(23)12(2)21(14-9-10-16(20)15(19)11-14)17(22)13-7-5-4-6-8-13/h4-12H,3H2,1-2H3 |
cas번호 |
339-59-3 |
분자 구조 |
|
밀도 |
1.281g/cm3 |
녹는 점 |
115-119℃ |
비등점 |
470.6°C at 760 mmHg |
굴절 지수 |
1.578 |
인화점 |
238.4°C |
증기압 |
5.01E-09mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|