ChemNet > CAS > 33904-04-0 3,4-Dimethoxyphenyl isothiocyanate
33904-04-0 3,4-Dimethoxyphenyl isothiocyanate
| 상품명칭 |
3,4-Dimethoxyphenyl isothiocyanate |
| 영문 이름 |
3,4-Dimethoxyphenyl isothiocyanate; 3,4-Dimethoxyisothiocyanatobenzene; 4-isothiocyanato-1,2-dimethoxybenzene |
| 분자식 |
C9H9NO2S |
| 분자량 |
195.2383 |
| InChI |
InChI=1/C9H9NO2S/c1-11-8-4-3-7(10-6-13)5-9(8)12-2/h3-5H,1-2H3 |
| cas번호 |
33904-04-0 |
| 분자 구조 |
|
| 밀도 |
1.12g/cm3 |
| 녹는 점 |
47-172℃ |
| 비등점 |
311°C at 760 mmHg |
| 굴절 지수 |
1.537 |
| 인화점 |
141.9°C |
| 증기압 |
0.00106mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
