| 상품명칭 |
하이드록시옥타데카노산, 프로판-1,2-디올을 함유한 모노에스테르 |
| 별명 |
Octadecanoic 산, 12-hydroxy-, 1,2-propanediol를 가진 monoester; 프로필렌 글리콜 히드록시스테아레이트; 하이드록시옥타데카노산, 프로판-1,2-디올을 함유한 모노에스테르; 2-하이드록시옥타데카노에이트; 프로판 -1,2- 디올 |
| 영문 이름 |
hydroxyoctadecanoic acid, monoester with propane-1,2-diol;Octadecanoic acid, 12-hydroxy-, monoester with 1,2-propanediol; Propylene glycol hydroxystearate; Hydroxyoctadecanoic acid, monoester with propane-1,2-diol; 2-hydroxyoctadecanoate; propane-1,2-diol |
| 분자식 |
C21H43O5 |
| 분자량 |
375.5637 |
| InChI |
InChI=1/C18H36O3.C3H8O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21;1-3(5)2-4/h17,19H,2-16H2,1H3,(H,20,21);3-5H,2H2,1H3/p-1 |
| cas번호 |
33907-47-0 |
| EC번호 |
251-734-5 |
| 분자 구조 |
|
| 비등점 |
432.6°C at 760 mmHg |
| 인화점 |
229.6°C |
| 증기압 |
2.67E-09mmHg at 25°C |
|