ChemNet > CAS > 3396-11-0 Cesium acetate
3396-11-0 Cesium acetate
| 상품명칭 |
Cesium acetate |
| 영문 이름 |
Cesium acetate; Cesiumacetatetech; Cesiumacetatelump; Cesium acetate,(99.9% Cs); caesium acetate |
| 분자식 |
C2H3CsO2 |
| 분자량 |
191.9495 |
| InChI |
InChI=1/C2H4O2.Cs/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| cas번호 |
3396-11-0 |
| EC번호 |
222-248-0 |
| 분자 구조 |
|
| 녹는 점 |
194-195℃ |
| 비등점 |
117.1°C at 760 mmHg |
| 인화점 |
40°C |
| 증기압 |
13.9mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
