ChemNet > CAS > 343-27-1 Harmine hydrochloride hydrate
343-27-1 Harmine hydrochloride hydrate
| 상품명칭 |
Harmine hydrochloride hydrate |
| 영문 이름 |
Harmine hydrochloride hydrate; 7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole hydrochloride hydrate; Harmine hydrochlorid; Banisterine, Telepathine; 7-methoxy-1-methyl-9H-beta-carbolin-9-ium chloride; Harmine Hydrochloride |
| 분자식 |
C13H13ClN2O |
| 분자량 |
248.7081 |
| InChI |
InChI=1/C13H12N2O.ClH/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;/h3-7,15H,1-2H3;1H |
| cas번호 |
343-27-1 |
| EC번호 |
206-443-8 |
| 분자 구조 |
|
| 녹는 점 |
265-270℃ |
| 비등점 |
421.4°C at 760 mmHg |
| 인화점 |
139.8°C |
| 증기압 |
6.42E-07mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R40:Possible risks of irreversible effects.;
|
| 보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
