3440-24-2 3',4',7,8-테트라하이드록시플라본
상품명칭 |
3',4',7,8-테트라하이드록시플라본 |
별명 |
2-(3,4-디히드록시페닐)-7,8-디히드록시-4H-크로멘-4-온 |
영문 이름 |
3',4',7,8-Tetrahydroxyflavone;2-(3,4-dihydroxyphenyl)-7,8-dihydroxy-4H-chromen-4-one |
분자식 |
C15H10O6 |
분자량 |
286.2363 |
InChI |
InChI=1/C15H10O6/c16-9-3-1-7(5-12(9)19)13-6-11(18)8-2-4-10(17)14(20)15(8)21-13/h1-6,16-17,19-20H |
cas번호 |
3440-24-2 |
분자 구조 |
|
밀도 |
1.654g/cm3 |
비등점 |
618.9°C at 760 mmHg |
굴절 지수 |
1.767 |
인화점 |
240.6°C |
증기압 |
6.57E-16mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|