ChemNet > CAS > 34420-17-2 2-Phenylethyl-1-boronic acid
34420-17-2 2-Phenylethyl-1-boronic acid
상품명칭 |
2-Phenylethyl-1-boronic acid |
영문 이름 |
2-Phenylethyl-1-boronic acid; Phenethylboronic acid; (2-phenylethyl)boronic acid; [(E)-2-phenylethenyl]boronic acid; 2-Phenylethaneboronic acid; Phenylethaneboronic Acid |
분자식 |
C8H9BO2 |
분자량 |
147.9669 |
InChI |
InChI=1/C8H9BO2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7,10-11H/b7-6+ |
cas번호 |
34420-17-2 |
분자 구조 |
|
밀도 |
1.13g/cm3 |
비등점 |
315.9°C at 760 mmHg |
굴절 지수 |
1.587 |
인화점 |
144.9°C |
증기압 |
0.000179mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|