ChemNet > CAS > 34490-86-3 Dimethyl suberimidate dihydrochloride
34490-86-3 Dimethyl suberimidate dihydrochloride
상품명칭 |
Dimethyl suberimidate dihydrochloride |
영문 이름 |
Dimethyl suberimidate dihydrochloride; Suberimidic acid dimethyl ester dihydrochloride; dimethyl (1Z,8Z)-octanebis(imidoate); dimethyl (1Z,8Z)-octanebis(imidoate) dihydrochloride; dimethyl octanebis(imidoate) |
분자식 |
C10H20N2O2 |
분자량 |
200.278 |
InChI |
InChI=1/C10H20N2O2/c1-13-9(11)7-5-3-4-6-8-10(12)14-2/h11-12H,3-8H2,1-2H3 |
cas번호 |
34490-86-3 |
EC번호 |
252-060-4 |
분자 구조 |
|
밀도 |
1.01g/cm3 |
녹는 점 |
213-216℃ |
비등점 |
247.437°C at 760 mmHg |
굴절 지수 |
1.465 |
인화점 |
103.447°C |
증기압 |
0.04mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|