ChemNet > CAS > 3468-17-5 6-(Aminomethyl)indole
3468-17-5 6-(Aminomethyl)indole
| 상품명칭 |
6-(Aminomethyl)indole |
| 영문 이름 |
6-(Aminomethyl)indole; INDOLE-6-METHYLAMINE; 1H-INDOLE-6-METHANAMINE; ; 1-(1H-indol-6-yl)methanamine |
| 분자식 |
C9H10N2 |
| 분자량 |
146.1891 |
| InChI |
InChI=1/C9H10N2/c10-6-7-1-2-8-3-4-11-9(8)5-7/h1-5,11H,6,10H2 |
| cas번호 |
3468-17-5 |
| 분자 구조 |
|
| 밀도 |
1.2g/cm3 |
| 비등점 |
335.599°C at 760 mmHg |
| 굴절 지수 |
1.698 |
| 인화점 |
183.277°C |
| 증기압 |
0mmHg at 25°C |
| 위험성 표시 |
 Xi:;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
