ChemNet > CAS > 3468-53-9 Phenyl nicotinate
3468-53-9 Phenyl nicotinate
| 상품명칭 |
Phenyl nicotinate |
| 영문 이름 |
Phenyl nicotinate; Phenyl nicotinate, (Nicotinic acid phenyl ester; Nicotinic acid phenyl ester~Phenyl pyridine-3-carboxylate; phenyl pyridine-3-carboxylate |
| 분자식 |
C12H9NO2 |
| 분자량 |
199.2054 |
| InChI |
InChI=1/C12H9NO2/c14-12(10-5-4-8-13-9-10)15-11-6-2-1-3-7-11/h1-9H |
| cas번호 |
3468-53-9 |
| EC번호 |
222-428-9 |
| 분자 구조 |
|
| 밀도 |
1.199g/cm3 |
| 녹는 점 |
70-72℃ |
| 비등점 |
338.9°C at 760 mmHg |
| 굴절 지수 |
1.589 |
| 인화점 |
158.8°C |
| 증기압 |
9.51E-05mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R43:May cause sensitization by skin contact.;
|
| 보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
