3491-63-2 2-Phenyl-2-pentenal
상품명칭 |
2-Phenyl-2-pentenal |
영문 이름 |
2-Phenyl-2-pentenal;Benzeneacetaldehyde, alpha-propylidene-; (2E)-2-phenylpent-2-enal |
분자식 |
C11H12O |
분자량 |
160.2124 |
InChI |
InChI=1/C11H12O/c1-2-6-11(9-12)10-7-4-3-5-8-10/h3-9H,2H2,1H3/b11-6- |
cas번호 |
3491-63-2 |
분자 구조 |
|
밀도 |
0.976g/cm3 |
비등점 |
286.7°C at 760 mmHg |
굴절 지수 |
1.524 |
인화점 |
106.2°C |
증기압 |
0.0026mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|