ChemNet > CAS > 3512-18-3 2,3,6-Trifluoropyridine
3512-18-3 2,3,6-Trifluoropyridine
| 상품명칭 |
2,3,6-Trifluoropyridine |
| 영문 이름 |
2,3,6-Trifluoropyridine; |
| 분자식 |
C5H2F3N |
| 분자량 |
133.0713 |
| InChI |
InChI=1/C5H2F3N/c6-3-1-2-4(7)9-5(3)8/h1-2H |
| cas번호 |
3512-18-3 |
| 분자 구조 |
|
| 밀도 |
1.396g/cm3 |
| 비등점 |
123.7°C at 760 mmHg |
| 굴절 지수 |
1.424 |
| 인화점 |
28.6°C |
| 증기압 |
15.9mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
