ChemNet > CAS > 35213-00-4 2,6-Dinitrobenzonitrile
35213-00-4 2,6-Dinitrobenzonitrile
| 상품명칭 |
2,6-Dinitrobenzonitrile |
| 영문 이름 |
2,6-Dinitrobenzonitrile;Dinitrobenzonitrile; Benzonitrile, 2,6-dinitro-; 2,3-dinitrobenzonitrile |
| 분자식 |
C7H3N3O4 |
| 분자량 |
193.1164 |
| InChI |
InChI=1/C7H3N3O4/c8-4-5-2-1-3-6(9(11)12)7(5)10(13)14/h1-3H |
| cas번호 |
35213-00-4 |
| 분자 구조 |
|
| 밀도 |
1.555g/cm3 |
| 비등점 |
387.959°C at 760 mmHg |
| 굴절 지수 |
1.616 |
| 인화점 |
188.431°C |
| 증기압 |
0mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
