ChemNet > CAS > 35364-79-5 3,4-Dichlorophenethylalcohol
35364-79-5 3,4-Dichlorophenethylalcohol
| 상품명칭 |
3,4-Dichlorophenethylalcohol |
| 영문 이름 |
3,4-Dichlorophenethylalcohol; 2-(3,4-dichlorophenyl)ethanol; 3,4-Dichlorophenethyl alcohol |
| 분자식 |
C8H8Cl2O |
| 분자량 |
191.0545 |
| InChI |
InChI=1/C8H8Cl2O/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,5,11H,3-4H2 |
| cas번호 |
35364-79-5 |
| 분자 구조 |
|
| 밀도 |
1.329g/cm3 |
| 비등점 |
279.1°C at 760 mmHg |
| 굴절 지수 |
1.569 |
| 인화점 |
117.9°C |
| 증기압 |
0.00196mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
