ChemNet > CAS > 35450-36-3 Methyl 2-bromo-5-methoxybenzoate
35450-36-3 Methyl 2-bromo-5-methoxybenzoate
| 상품명칭 |
Methyl 2-bromo-5-methoxybenzoate |
| 영문 이름 |
Methyl 2-bromo-5-methoxybenzoate; 2-Bromo-5-methoxybenzoic acid methyl ester |
| 분자식 |
C9H9BrO3 |
| 분자량 |
245.07 |
| InChI |
InChI=1/C9H9BrO3/c1-12-6-3-4-8(10)7(5-6)9(11)13-2/h3-5H,1-2H3 |
| cas번호 |
35450-36-3 |
| 분자 구조 |
|
| 밀도 |
1.462g/cm3 |
| 비등점 |
291.9°C at 760 mmHg |
| 굴절 지수 |
1.537 |
| 인화점 |
130.4°C |
| 증기압 |
0.00189mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
