ChemNet > CAS > 35541-81-2 1,4-cyclohexanedimethanol dibenzoate
35541-81-2 1,4-cyclohexanedimethanol dibenzoate
상품명칭 |
1,4-cyclohexanedimethanol dibenzoate |
영문 이름 |
1,4-cyclohexanedimethanol dibenzoate; 1,4-Cyclohexanedimethanol dibenzoate,mixture of cis and trans; cyclohexane-1,4-diyldimethanediyl dibenzoate; cyclohexane-1,4-diylbis(methylene) dibenzoate |
분자식 |
C22H24O4 |
분자량 |
352.4236 |
InChI |
InChI=1/C22H24O4/c23-21(19-7-3-1-4-8-19)25-15-17-11-13-18(14-12-17)16-26-22(24)20-9-5-2-6-10-20/h1-10,17-18H,11-16H2 |
cas번호 |
35541-81-2 |
분자 구조 |
|
밀도 |
1.125g/cm3 |
비등점 |
472.9°C at 760 mmHg |
굴절 지수 |
1.549 |
인화점 |
233.7°C |
증기압 |
4.13E-09mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|