ChemNet > CAS > 3556-83-0 Methyl 3-methoxy-4-methylbenzoate
3556-83-0 Methyl 3-methoxy-4-methylbenzoate
상품명칭 |
Methyl 3-methoxy-4-methylbenzoate |
영문 이름 |
Methyl 3-methoxy-4-methylbenzoate; 3-Methoxy-4-methylbenzoic acid methyl ester; 3-Methoxy-p-toluic acid methyl ester (COOCH3=1); methyl 4-methoxy-3-methylbenzoate |
분자식 |
C10H12O3 |
분자량 |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-7-6-8(10(11)13-3)4-5-9(7)12-2/h4-6H,1-3H3 |
cas번호 |
3556-83-0 |
분자 구조 |
|
밀도 |
1.075g/cm3 |
녹는 점 |
50-120℃ |
비등점 |
269.5°C at 760 mmHg |
굴절 지수 |
1.502 |
인화점 |
107.5°C |
증기압 |
0.00723mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|