ChemNet > CAS > 35778-58-6 5-(4-Diethylaminobenzylidene)rhodanine
35778-58-6 5-(4-Diethylaminobenzylidene)rhodanine
상품명칭 |
5-(4-Diethylaminobenzylidene)rhodanine |
영문 이름 |
5-(4-Diethylaminobenzylidene)rhodanine; 5-[4-(Diethylamino)benzylidene]rhodanine; (5E)-5-[4-(diethylamino)benzylidene]-2-sulfanyl-1,3-thiazol-4(5H)-one; (5Z)-5-[4-(diethylamino)benzylidene]-2-thioxo-1,3-thiazolidin-4-one; 5-{[4-(diethylamino)phenyl]methylidene}-2-thioxo-1,3-thiazolidin-4-one |
분자식 |
C14H16N2OS2 |
분자량 |
292.4196 |
InChI |
InChI=1/C14H16N2OS2/c1-3-16(4-2)11-7-5-10(6-8-11)9-12-13(17)15-14(18)19-12/h5-9H,3-4H2,1-2H3,(H,15,17,18) |
cas번호 |
35778-58-6 |
EC번호 |
252-723-8 |
분자 구조 |
|
밀도 |
1.29g/cm3 |
녹는 점 |
161-164℃ |
굴절 지수 |
1.668 |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|