359-13-7 2,2-difluoroethanol
상품명칭 |
2,2-difluoroethanol |
영문 이름 |
2,2-difluoroethanol; Difluoroethanol; chloroacetyl fluoride |
분자식 |
C2H2ClFO |
분자량 |
96.4881 |
InChI |
InChI=1/C2H2ClFO/c3-1-2(4)5/h1H2 |
cas번호 |
359-13-7 |
분자 구조 |
|
밀도 |
1.277g/cm3 |
비등점 |
109.2°C at 760 mmHg |
굴절 지수 |
1.352 |
인화점 |
19.8°C |
증기압 |
25.1mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R11:Highly flammable.;
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|