359-37-5 iodotrifluoroethylene
상품명칭 |
iodotrifluoroethylene |
영문 이름 |
iodotrifluoroethylene; Trifluoroiodoethylene; 1,1,2-trifluoro-2-iodoethene |
분자식 |
C2F3I |
분자량 |
207.9211 |
InChI |
InChI=1/C2F3I/c3-1(4)2(5)6 |
cas번호 |
359-37-5 |
EC번호 |
206-629-9 |
분자 구조 |
|
밀도 |
2.311g/cm3 |
비등점 |
30°C at 760 mmHg |
굴절 지수 |
1.457 |
증기압 |
636mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|