ChemNet > CAS > 3592-12-9 5,5-Dimethyl-1,3-dioxan-2-one
3592-12-9 5,5-Dimethyl-1,3-dioxan-2-one
상품명칭 |
5,5-Dimethyl-1,3-dioxan-2-one |
영문 이름 |
5,5-Dimethyl-1,3-dioxan-2-one; Neopentylene carbonate |
분자식 |
C6H10O3 |
분자량 |
130.1418 |
InChI |
InChI=1/C6H10O3/c1-6(2)3-8-5(7)9-4-6/h3-4H2,1-2H3 |
cas번호 |
3592-12-9 |
분자 구조 |
|
밀도 |
1.054g/cm3 |
비등점 |
231.5°C at 760 mmHg |
굴절 지수 |
1.417 |
인화점 |
114.5°C |
증기압 |
0.062mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|