ChemNet > CAS > 36176-31-5 2-Isopropylphenyl isothiocyanate
36176-31-5 2-Isopropylphenyl isothiocyanate
| 상품명칭 |
2-Isopropylphenyl isothiocyanate |
| 영문 이름 |
2-Isopropylphenyl isothiocyanate;1-isothiocyanato-2-(propan-2-yl)benzene |
| 분자식 |
C10H11NS |
| 분자량 |
177.266 |
| InChI |
InChI=1/C10H11NS/c1-8(2)9-5-3-4-6-10(9)11-7-12/h3-6,8H,1-2H3 |
| cas번호 |
36176-31-5 |
| 분자 구조 |
|
| 밀도 |
1g/cm3 |
| 비등점 |
268°C at 760 mmHg |
| 굴절 지수 |
1.547 |
| 인화점 |
117.3°C |
| 증기압 |
0.013mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
